C17H18F3N3O5S — CID 155832806
N-[(3S,3aR,6aS)-1-(furan-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-3-yl]-1,3-thiazole-4-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155832806) has the molecular formula C17H18F3N3O5S and a molecular weight of 433.41 g/mol. Its IUPAC name is N-[(3S,3aR,6aS)-1-(furan-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-3-yl]-1,3-thiazole-4-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[(3S,3aR,6aS)-1-(furan-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-3-yl]-1,3-thiazole-4-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155832806 |
| Molecular Formula | C17H18F3N3O5S |
| Molecular Weight | 433.41 g/mol |
| Exact Mass | 433.09 |
| IUPAC Name | N-[(3S,3aR,6aS)-1-(furan-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-3-yl]-1,3-thiazole-4-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(N[C@@H]1CN(Cc2ccco2)[C@@H]2COC[C@@H]21)c1cscn1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H17N3O3S.C2HF3O2/c19-15(13-8-22-9-16-13)17-12-5-18(4-10-2-1-3-21-10)14-7-20-6-11(12)14;3-2(4,5)1(6)7/h1-3,8-9,11-12,14H,4-7H2,(H,17,19);(H,6,7)/t11-,12-,14-;/m1./s1 |
| InChIKey | ZWLYJHZCNLHLIA-PGCMWVOQSA-N |
| XLogP | 2.00 |
| TPSA | 104.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.41 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |