C17H20F3N5O4S — CID 155826951
N-[(3S,3aR,6aS)-1-[(1-methylpyrazol-4-yl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-3-yl]-1,3-thiazole-4-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155826951) has the molecular formula C17H20F3N5O4S and a molecular weight of 447.44 g/mol. Its IUPAC name is N-[(3S,3aR,6aS)-1-[(1-methylpyrazol-4-yl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-3-yl]-1,3-thiazole-4-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[(3S,3aR,6aS)-1-[(1-methylpyrazol-4-yl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-3-yl]-1,3-thiazole-4-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155826951 |
| Molecular Formula | C17H20F3N5O4S |
| Molecular Weight | 447.44 g/mol |
| Exact Mass | 447.12 |
| IUPAC Name | N-[(3S,3aR,6aS)-1-[(1-methylpyrazol-4-yl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-3-yl]-1,3-thiazole-4-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | Cn1cc(CN2C[C@@H](NC(=O)c3cscn3)[C@H]3COC[C@H]32)cn1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H19N5O2S.C2HF3O2/c1-19-3-10(2-17-19)4-20-5-12(11-6-22-7-14(11)20)18-15(21)13-8-23-9-16-13;3-2(4,5)1(6)7/h2-3,8-9,11-12,14H,4-7H2,1H3,(H,18,21);(H,6,7)/t11-,12-,14-;/m1./s1 |
| InChIKey | QSBXBEUCPOEYSN-PGCMWVOQSA-N |
| XLogP | 1.14 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.44 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |