C16H21N5O2S — CID 124818685
N-[(3R,3aS,7aS)-1-(1,3-thiazol-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]-1-methylpyrazole-4-carboxamide (PubChem CID 124818685) has the molecular formula C16H21N5O2S and a molecular weight of 347.44 g/mol. Its IUPAC name is N-[(3R,3aS,7aS)-1-(1,3-thiazol-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]-1-methylpyrazole-4-carboxamide.
| Compound Name | N-[(3R,3aS,7aS)-1-(1,3-thiazol-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]-1-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 124818685 |
| Molecular Formula | C16H21N5O2S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | N-[(3R,3aS,7aS)-1-(1,3-thiazol-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]-1-methylpyrazole-4-carboxamide |
| SMILES | Cn1cc(C(=O)N[C@@H]2CN(Cc3nccs3)[C@H]3CCCO[C@@H]23)cn1 |
| InChI | InChI=1S/C16H21N5O2S/c1-20-8-11(7-18-20)16(22)19-12-9-21(10-14-17-4-6-24-14)13-3-2-5-23-15(12)13/h4,6-8,12-13,15H,2-3,5,9-10H2,1H3,(H,19,22)/t12-,13+,15+/m1/s1 |
| InChIKey | OCQOLARSEPPWKZ-IPYPFGDCSA-N |
| XLogP | 1.04 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |