C15H23N3O2S — CID 97460311
(3S,3aR,7aS)-3-morpholin-4-yl-1-(1,3-thiazol-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole (PubChem CID 97460311) has the molecular formula C15H23N3O2S and a molecular weight of 309.44 g/mol. Its IUPAC name is (3S,3aR,7aS)-3-morpholin-4-yl-1-(1,3-thiazol-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole.
| Compound Name | (3S,3aR,7aS)-3-morpholin-4-yl-1-(1,3-thiazol-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole |
|---|---|
| PubChem CID | 97460311 |
| Molecular Formula | C15H23N3O2S |
| Molecular Weight | 309.44 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | (3S,3aR,7aS)-3-morpholin-4-yl-1-(1,3-thiazol-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole |
| SMILES | c1csc(CN2C[C@H](N3CCOCC3)[C@@H]3OCCC[C@@H]32)n1 |
| InChI | InChI=1S/C15H23N3O2S/c1-2-12-15(20-6-1)13(17-4-7-19-8-5-17)10-18(12)11-14-16-3-9-21-14/h3,9,12-13,15H,1-2,4-8,10-11H2/t12-,13-,15+/m0/s1 |
| InChIKey | DLEHYVDMSOAQFD-KCQAQPDRSA-N |
| XLogP | 1.21 |
| TPSA | 37.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.44 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |