C18H28N2O3 — CID 134690071
(3S)-1-[(4,5-dimethylfuran-2-yl)methyl]-3-morpholin-4-yl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole (PubChem CID 134690071) has the molecular formula C18H28N2O3 and a molecular weight of 320.43 g/mol. Its IUPAC name is (3S)-1-[(4,5-dimethylfuran-2-yl)methyl]-3-morpholin-4-yl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole.
| Compound Name | (3S)-1-[(4,5-dimethylfuran-2-yl)methyl]-3-morpholin-4-yl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole |
|---|---|
| PubChem CID | 134690071 |
| Molecular Formula | C18H28N2O3 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.21 |
| IUPAC Name | (3S)-1-[(4,5-dimethylfuran-2-yl)methyl]-3-morpholin-4-yl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole |
| SMILES | Cc1cc(CN2C[C@H](N3CCOCC3)C3OCCCC32)oc1C |
| InChI | InChI=1S/C18H28N2O3/c1-13-10-15(23-14(13)2)11-20-12-17(19-5-8-21-9-6-19)18-16(20)4-3-7-22-18/h10,16-18H,3-9,11-12H2,1-2H3/t16?,17-,18?/m0/s1 |
| InChIKey | ZOENCTOOTINXNH-ADKAHSJRSA-N |
| XLogP | 1.96 |
| TPSA | 38.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |