C17H26N2O3 — CID 125194926
(3S,3aS,7aS)-1-[(5-methylfuran-2-yl)methyl]-3-morpholin-4-yl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole (PubChem CID 125194926) has the molecular formula C17H26N2O3 and a molecular weight of 306.41 g/mol. Its IUPAC name is (3S,3aS,7aS)-1-[(5-methylfuran-2-yl)methyl]-3-morpholin-4-yl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole.
| Compound Name | (3S,3aS,7aS)-1-[(5-methylfuran-2-yl)methyl]-3-morpholin-4-yl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole |
|---|---|
| PubChem CID | 125194926 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | (3S,3aS,7aS)-1-[(5-methylfuran-2-yl)methyl]-3-morpholin-4-yl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole |
| SMILES | Cc1ccc(CN2C[C@H](N3CCOCC3)[C@H]3OCCC[C@@H]32)o1 |
| InChI | InChI=1S/C17H26N2O3/c1-13-4-5-14(22-13)11-19-12-16(18-6-9-20-10-7-18)17-15(19)3-2-8-21-17/h4-5,15-17H,2-3,6-12H2,1H3/t15-,16-,17-/m0/s1 |
| InChIKey | CLOWHJIOZFSRLX-ULQDDVLXSA-N |
| XLogP | 1.65 |
| TPSA | 38.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |