C21H23N5O — CID 92596041
(2R,6R)-4-[(4-methoxyphenyl)methyl]-12-pyridin-4-yl-1,4,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-diene (PubChem CID 92596041) has the molecular formula C21H23N5O and a molecular weight of 361.45 g/mol. Its IUPAC name is (2R,6R)-4-[(4-methoxyphenyl)methyl]-12-pyridin-4-yl-1,4,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-diene.
| Compound Name | (2R,6R)-4-[(4-methoxyphenyl)methyl]-12-pyridin-4-yl-1,4,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-diene |
|---|---|
| PubChem CID | 92596041 |
| Molecular Formula | C21H23N5O |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | (2R,6R)-4-[(4-methoxyphenyl)methyl]-12-pyridin-4-yl-1,4,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-diene |
| SMILES | COc1ccc(CN2C[C@H]3CCc4nnc(-c5ccncc5)n4[C@H]3C2)cc1 |
| InChI | InChI=1S/C21H23N5O/c1-27-18-5-2-15(3-6-18)12-25-13-17-4-7-20-23-24-21(26(20)19(17)14-25)16-8-10-22-11-9-16/h2-3,5-6,8-11,17,19H,4,7,12-14H2,1H3/t17-,19+/m1/s1 |
| InChIKey | XXKMNYWUAJXTQO-MJGOQNOKSA-N |
| XLogP | 2.97 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |