C19H23N3O2S — CID 124804804
(3aR,6aS)-2-[(4-methoxyphenyl)methyl]-5-[(2-methyl-1,3-thiazol-4-yl)methyl]-3,3a,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-4-one (PubChem CID 124804804) has the molecular formula C19H23N3O2S and a molecular weight of 357.48 g/mol. Its IUPAC name is (3aR,6aS)-2-[(4-methoxyphenyl)methyl]-5-[(2-methyl-1,3-thiazol-4-yl)methyl]-3,3a,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-4-one.
| Compound Name | (3aR,6aS)-2-[(4-methoxyphenyl)methyl]-5-[(2-methyl-1,3-thiazol-4-yl)methyl]-3,3a,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-4-one |
|---|---|
| PubChem CID | 124804804 |
| Molecular Formula | C19H23N3O2S |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | (3aR,6aS)-2-[(4-methoxyphenyl)methyl]-5-[(2-methyl-1,3-thiazol-4-yl)methyl]-3,3a,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-4-one |
| SMILES | COc1ccc(CN2C[C@H]3CN(Cc4csc(C)n4)C(=O)[C@H]3C2)cc1 |
| InChI | InChI=1S/C19H23N3O2S/c1-13-20-16(12-25-13)10-22-9-15-8-21(11-18(15)19(22)23)7-14-3-5-17(24-2)6-4-14/h3-6,12,15,18H,7-11H2,1-2H3/t15-,18-/m0/s1 |
| InChIKey | WHTCRLIBBQTTCA-YJBOKZPZSA-N |
| XLogP | 2.55 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |