C16H19N5O2S — CID 124816169
(3aS,6aS)-2-(1-methylpyrazole-4-carbonyl)-5-[(2-methyl-1,3-thiazol-4-yl)methyl]-3,3a,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-4-one (PubChem CID 124816169) has the molecular formula C16H19N5O2S and a molecular weight of 345.43 g/mol. Its IUPAC name is (3aS,6aS)-2-(1-methylpyrazole-4-carbonyl)-5-[(2-methyl-1,3-thiazol-4-yl)methyl]-3,3a,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-4-one.
| Compound Name | (3aS,6aS)-2-(1-methylpyrazole-4-carbonyl)-5-[(2-methyl-1,3-thiazol-4-yl)methyl]-3,3a,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-4-one |
|---|---|
| PubChem CID | 124816169 |
| Molecular Formula | C16H19N5O2S |
| Molecular Weight | 345.43 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | (3aS,6aS)-2-(1-methylpyrazole-4-carbonyl)-5-[(2-methyl-1,3-thiazol-4-yl)methyl]-3,3a,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-4-one |
| SMILES | Cc1nc(CN2C[C@H]3CN(C(=O)c4cnn(C)c4)C[C@H]3C2=O)cs1 |
| InChI | InChI=1S/C16H19N5O2S/c1-10-18-13(9-24-10)7-20-5-12-6-21(8-14(12)16(20)23)15(22)11-3-17-19(2)4-11/h3-4,9,12,14H,5-8H2,1-2H3/t12-,14+/m0/s1 |
| InChIKey | IBPWFOFXSRNILU-GXTWGEPZSA-N |
| XLogP | 0.92 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.43 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |