C21H21N5O2 — CID 92601261
(2-methoxyphenyl)-[(2R,6R)-12-pyridin-4-yl-1,4,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-dien-4-yl]methanone (PubChem CID 92601261) has the molecular formula C21H21N5O2 and a molecular weight of 375.43 g/mol. Its IUPAC name is (2-methoxyphenyl)-[(2R,6R)-12-pyridin-4-yl-1,4,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-dien-4-yl]methanone.
| Compound Name | (2-methoxyphenyl)-[(2R,6R)-12-pyridin-4-yl-1,4,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-dien-4-yl]methanone |
|---|---|
| PubChem CID | 92601261 |
| Molecular Formula | C21H21N5O2 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | (2-methoxyphenyl)-[(2R,6R)-12-pyridin-4-yl-1,4,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-dien-4-yl]methanone |
| SMILES | COc1ccccc1C(=O)N1C[C@H]2CCc3nnc(-c4ccncc4)n3[C@H]2C1 |
| InChI | InChI=1S/C21H21N5O2/c1-28-18-5-3-2-4-16(18)21(27)25-12-15-6-7-19-23-24-20(26(19)17(15)13-25)14-8-10-22-11-9-14/h2-5,8-11,15,17H,6-7,12-13H2,1H3/t15-,17+/m1/s1 |
| InChIKey | JBIRZNCVDHDPCR-WBVHZDCISA-N |
| XLogP | 2.61 |
| TPSA | 73.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |