C20H20N6O — CID 92563042
(5-methylpyrazin-2-yl)-[(2R,6R)-12-phenyl-1,4,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-dien-4-yl]methanone (PubChem CID 92563042) has the molecular formula C20H20N6O and a molecular weight of 360.42 g/mol. Its IUPAC name is (5-methylpyrazin-2-yl)-[(2R,6R)-12-phenyl-1,4,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-dien-4-yl]methanone.
| Compound Name | (5-methylpyrazin-2-yl)-[(2R,6R)-12-phenyl-1,4,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-dien-4-yl]methanone |
|---|---|
| PubChem CID | 92563042 |
| Molecular Formula | C20H20N6O |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | (5-methylpyrazin-2-yl)-[(2R,6R)-12-phenyl-1,4,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-dien-4-yl]methanone |
| SMILES | Cc1cnc(C(=O)N2C[C@H]3CCc4nnc(-c5ccccc5)n4[C@H]3C2)cn1 |
| InChI | InChI=1S/C20H20N6O/c1-13-9-22-16(10-21-13)20(27)25-11-15-7-8-18-23-24-19(26(18)17(15)12-25)14-5-3-2-4-6-14/h2-6,9-10,15,17H,7-8,11-12H2,1H3/t15-,17+/m1/s1 |
| InChIKey | CRSLVWBCNIPXNA-WBVHZDCISA-N |
| XLogP | 2.30 |
| TPSA | 76.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |