C21H21N5O2 — CID 92602512
[(2R,6R)-12-(2-methoxyphenyl)-1,4,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-dien-4-yl]-pyridin-2-ylmethanone (PubChem CID 92602512) has the molecular formula C21H21N5O2 and a molecular weight of 375.43 g/mol. Its IUPAC name is [(2R,6R)-12-(2-methoxyphenyl)-1,4,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-dien-4-yl]-pyridin-2-ylmethanone.
| Compound Name | [(2R,6R)-12-(2-methoxyphenyl)-1,4,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-dien-4-yl]-pyridin-2-ylmethanone |
|---|---|
| PubChem CID | 92602512 |
| Molecular Formula | C21H21N5O2 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | [(2R,6R)-12-(2-methoxyphenyl)-1,4,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-dien-4-yl]-pyridin-2-ylmethanone |
| SMILES | COc1ccccc1-c1nnc2n1[C@H]1CN(C(=O)c3ccccn3)C[C@H]1CC2 |
| InChI | InChI=1S/C21H21N5O2/c1-28-18-8-3-2-6-15(18)20-24-23-19-10-9-14-12-25(13-17(14)26(19)20)21(27)16-7-4-5-11-22-16/h2-8,11,14,17H,9-10,12-13H2,1H3/t14-,17+/m1/s1 |
| InChIKey | CYSDJTFZTYDSRN-PBHICJAKSA-N |
| XLogP | 2.61 |
| TPSA | 73.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |