C17H22N4 — CID 92560886
(2R,6R)-12-methyl-4-[(3-methylphenyl)methyl]-1,4,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-diene (PubChem CID 92560886) has the molecular formula C17H22N4 and a molecular weight of 282.39 g/mol. Its IUPAC name is (2R,6R)-12-methyl-4-[(3-methylphenyl)methyl]-1,4,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-diene.
| Compound Name | (2R,6R)-12-methyl-4-[(3-methylphenyl)methyl]-1,4,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-diene |
|---|---|
| PubChem CID | 92560886 |
| Molecular Formula | C17H22N4 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | (2R,6R)-12-methyl-4-[(3-methylphenyl)methyl]-1,4,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-diene |
| SMILES | Cc1cccc(CN2C[C@H]3CCc4nnc(C)n4[C@H]3C2)c1 |
| InChI | InChI=1S/C17H22N4/c1-12-4-3-5-14(8-12)9-20-10-15-6-7-17-19-18-13(2)21(17)16(15)11-20/h3-5,8,15-16H,6-7,9-11H2,1-2H3/t15-,16+/m1/s1 |
| InChIKey | OSMLWAOFYZNYJM-CVEARBPZSA-N |
| XLogP | 2.51 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |