C15H20N2 — CID 123403023
6-[(3-methylphenyl)methyl]-2,3,4,4a,5,7-hexahydropyrrolo[3,4-b]pyridine (PubChem CID 123403023) has the molecular formula C15H20N2 and a molecular weight of 228.34 g/mol. Its IUPAC name is 6-[(3-methylphenyl)methyl]-2,3,4,4a,5,7-hexahydropyrrolo[3,4-b]pyridine.
| Compound Name | 6-[(3-methylphenyl)methyl]-2,3,4,4a,5,7-hexahydropyrrolo[3,4-b]pyridine |
|---|---|
| PubChem CID | 123403023 |
| Molecular Formula | C15H20N2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | 6-[(3-methylphenyl)methyl]-2,3,4,4a,5,7-hexahydropyrrolo[3,4-b]pyridine |
| SMILES | Cc1cccc(CN2CC3=NCCCC3C2)c1 |
| InChI | InChI=1S/C15H20N2/c1-12-4-2-5-13(8-12)9-17-10-14-6-3-7-16-15(14)11-17/h2,4-5,8,14H,3,6-7,9-11H2,1H3 |
| InChIKey | DKSSJUQMWSPMLW-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |