C14H25NOSi2 — CID 5146878
2,2,6,6-tetramethyl-4-[(3-methylphenyl)methyl]-1,4,2,6-oxazadisilinane (PubChem CID 5146878) has the molecular formula C14H25NOSi2 and a molecular weight of 279.53 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-4-[(3-methylphenyl)methyl]-1,4,2,6-oxazadisilinane.
| Compound Name | 2,2,6,6-tetramethyl-4-[(3-methylphenyl)methyl]-1,4,2,6-oxazadisilinane |
|---|---|
| PubChem CID | 5146878 |
| Molecular Formula | C14H25NOSi2 |
| Molecular Weight | 279.53 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | 2,2,6,6-tetramethyl-4-[(3-methylphenyl)methyl]-1,4,2,6-oxazadisilinane |
| SMILES | Cc1cccc(CN2C[Si](C)(C)O[Si](C)(C)C2)c1 |
| InChI | InChI=1S/C14H25NOSi2/c1-13-7-6-8-14(9-13)10-15-11-17(2,3)16-18(4,5)12-15/h6-9H,10-12H2,1-5H3 |
| InChIKey | RFUPLNHOBBBKOH-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.53 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|