C16H26N2 — CID 45366485
1-[(3-methylphenyl)methyl]-4-(2-methylpropyl)piperazine (PubChem CID 45366485) has the molecular formula C16H26N2 and a molecular weight of 246.40 g/mol. Its IUPAC name is 1-[(3-methylphenyl)methyl]-4-(2-methylpropyl)piperazine.
| Compound Name | 1-[(3-methylphenyl)methyl]-4-(2-methylpropyl)piperazine |
|---|---|
| PubChem CID | 45366485 |
| Molecular Formula | C16H26N2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | 1-[(3-methylphenyl)methyl]-4-(2-methylpropyl)piperazine |
| SMILES | Cc1cccc(CN2CCN(CC(C)C)CC2)c1 |
| InChI | InChI=1S/C16H26N2/c1-14(2)12-17-7-9-18(10-8-17)13-16-6-4-5-15(3)11-16/h4-6,11,14H,7-10,12-13H2,1-3H3 |
| InChIKey | QPBSKRCUQQJYMP-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |