C19H28N4 — CID 56881830
1-[(3-methylphenyl)methyl]-4-[(1-propan-2-ylimidazol-2-yl)methyl]piperazine (PubChem CID 56881830) has the molecular formula C19H28N4 and a molecular weight of 312.46 g/mol. Its IUPAC name is 1-[(3-methylphenyl)methyl]-4-[(1-propan-2-ylimidazol-2-yl)methyl]piperazine.
| Compound Name | 1-[(3-methylphenyl)methyl]-4-[(1-propan-2-ylimidazol-2-yl)methyl]piperazine |
|---|---|
| PubChem CID | 56881830 |
| Molecular Formula | C19H28N4 |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.23 |
| IUPAC Name | 1-[(3-methylphenyl)methyl]-4-[(1-propan-2-ylimidazol-2-yl)methyl]piperazine |
| SMILES | Cc1cccc(CN2CCN(Cc3nccn3C(C)C)CC2)c1 |
| InChI | InChI=1S/C19H28N4/c1-16(2)23-8-7-20-19(23)15-22-11-9-21(10-12-22)14-18-6-4-5-17(3)13-18/h4-8,13,16H,9-12,14-15H2,1-3H3 |
| InChIKey | WEUNMHHODQAZAC-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |