About 3-[[(3-ethoxy-2,2-diethylcyclobutyl)-methylamino]methyl]benzoic acid
3-[[(3-ethoxy-2,2-diethylcyclobutyl)-methylamino]methyl]benzoic acid (PubChem CID 122029387) has the molecular formula C19H29NO3
and a molecular weight of 319.44 g/mol. Its IUPAC name is 3-[[(3-ethoxy-2,2-diethylcyclobutyl)-methylamino]methyl]benzoic acid.
Molecular Properties
| Compound Name | 3-[[(3-ethoxy-2,2-diethylcyclobutyl)-methylamino]methyl]benzoic acid |
| PubChem CID | 122029387 |
| Molecular Formula | C19H29NO3 |
| Molecular Weight | 319.44 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | 3-[[(3-ethoxy-2,2-diethylcyclobutyl)-methylamino]methyl]benzoic acid |
| SMILES | CCOC1CC(N(C)Cc2cccc(C(=O)O)c2)C1(CC)CC |
| InChI | InChI=1S/C19H29NO3/c1-5-19(6-2)16(12-17(19)23-7-3)20(4)13-14-9-8-10-15(11-14)18(21)22/h8-11,16-17H,5-7,12-13H2,1-4H3,(H,21,22) |
| InChIKey | NCYRTFYIHCCBAE-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.44 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[[(3-ethoxy-2,2-diethylcyclobutyl)-methylamino]methyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[(3-ethoxy-2,2-diethylcyclobutyl)-methylamino]methyl]benzoic acid?
The IUPAC name of 3-[[(3-ethoxy-2,2-diethylcyclobutyl)-methylamino]methyl]benzoic acid (CID 122029387) is 3-[[(3-ethoxy-2,2-diethylcyclobutyl)-methylamino]methyl]benzoic acid.
What is the SMILES notation for 3-[[(3-ethoxy-2,2-diethylcyclobutyl)-methylamino]methyl]benzoic acid?
The canonical SMILES for 3-[[(3-ethoxy-2,2-diethylcyclobutyl)-methylamino]methyl]benzoic acid is CCOC1CC(N(C)Cc2cccc(C(=O)O)c2)C1(CC)CC.
What is the InChIKey of 3-[[(3-ethoxy-2,2-diethylcyclobutyl)-methylamino]methyl]benzoic acid?
The InChIKey is NCYRTFYIHCCBAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H29NO3/c1-5-19(6-2)16(12-17(19)23-7-3)20(4)13-14-9-8-10-15(11-14)18(21)22/h8-11,16-17H,5-7,12-13H2,1-4H3,(H,21,22).
What are the key properties of 3-[[(3-ethoxy-2,2-diethylcyclobutyl)-methylamino]methyl]benzoic acid?
3-[[(3-ethoxy-2,2-diethylcyclobutyl)-methylamino]methyl]benzoic acid has a molecular weight of 319.44 g/mol, XLogP of 3.80, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[(3-ethoxy-2,2-diethylcyclobutyl)-methylamino]methyl]benzoic acid is sourced from PubChem (CID 122029387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).