C18H26N2O3 — CID 122029485
4-[4-(3-methylbutanoylamino)anilino]cyclohexane-1-carboxylic acid (PubChem CID 122029485) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is 4-[4-(3-methylbutanoylamino)anilino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[4-(3-methylbutanoylamino)anilino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 122029485 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | 4-[4-(3-methylbutanoylamino)anilino]cyclohexane-1-carboxylic acid |
| SMILES | CC(C)CC(=O)Nc1ccc(NC2CCC(C(=O)O)CC2)cc1 |
| InChI | InChI=1S/C18H26N2O3/c1-12(2)11-17(21)20-16-9-7-15(8-10-16)19-14-5-3-13(4-6-14)18(22)23/h7-10,12-14,19H,3-6,11H2,1-2H3,(H,20,21)(H,22,23) |
| InChIKey | BAAUZPGOXHOAKB-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |