C19H26N2O3S — CID 122029766
4-[2-methyl-5-(thiomorpholine-4-carbonyl)anilino]cyclohexane-1-carboxylic acid (PubChem CID 122029766) has the molecular formula C19H26N2O3S and a molecular weight of 362.50 g/mol. Its IUPAC name is 4-[2-methyl-5-(thiomorpholine-4-carbonyl)anilino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[2-methyl-5-(thiomorpholine-4-carbonyl)anilino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 122029766 |
| Molecular Formula | C19H26N2O3S |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | 4-[2-methyl-5-(thiomorpholine-4-carbonyl)anilino]cyclohexane-1-carboxylic acid |
| SMILES | Cc1ccc(C(=O)N2CCSCC2)cc1NC1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C19H26N2O3S/c1-13-2-3-15(18(22)21-8-10-25-11-9-21)12-17(13)20-16-6-4-14(5-7-16)19(23)24/h2-3,12,14,16,20H,4-11H2,1H3,(H,23,24) |
| InChIKey | VWFVZSWFOWMRMK-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |