C15H19Cl2NO2 — CID 122030535
4-[2-(2,3-dichlorophenyl)ethylamino]cyclohexane-1-carboxylic acid (PubChem CID 122030535) has the molecular formula C15H19Cl2NO2 and a molecular weight of 316.23 g/mol. Its IUPAC name is 4-[2-(2,3-dichlorophenyl)ethylamino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[2-(2,3-dichlorophenyl)ethylamino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 122030535 |
| Molecular Formula | C15H19Cl2NO2 |
| Molecular Weight | 316.23 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | 4-[2-(2,3-dichlorophenyl)ethylamino]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(NCCc2cccc(Cl)c2Cl)CC1 |
| InChI | InChI=1S/C15H19Cl2NO2/c16-13-3-1-2-10(14(13)17)8-9-18-12-6-4-11(5-7-12)15(19)20/h1-3,11-12,18H,4-9H2,(H,19,20) |
| InChIKey | WQOCDUICAYKJDB-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.23 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |