C14H18Cl2N2O — CID 43224238
1-[4-[(2,3-dichlorophenyl)methylamino]piperidin-1-yl]ethanone (PubChem CID 43224238) has the molecular formula C14H18Cl2N2O and a molecular weight of 301.22 g/mol. Its IUPAC name is 1-[4-[(2,3-dichlorophenyl)methylamino]piperidin-1-yl]ethanone.
| Compound Name | 1-[4-[(2,3-dichlorophenyl)methylamino]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 43224238 |
| Molecular Formula | C14H18Cl2N2O |
| Molecular Weight | 301.22 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 1-[4-[(2,3-dichlorophenyl)methylamino]piperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCC(NCc2cccc(Cl)c2Cl)CC1 |
| InChI | InChI=1S/C14H18Cl2N2O/c1-10(19)18-7-5-12(6-8-18)17-9-11-3-2-4-13(15)14(11)16/h2-4,12,17H,5-9H2,1H3 |
| InChIKey | OVDVZXWZKITCST-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.22 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |