C14H17Cl3N2O — CID 43234694
1-[4-[(2,3,6-trichlorophenyl)methylamino]piperidin-1-yl]ethanone (PubChem CID 43234694) has the molecular formula C14H17Cl3N2O and a molecular weight of 335.66 g/mol. Its IUPAC name is 1-[4-[(2,3,6-trichlorophenyl)methylamino]piperidin-1-yl]ethanone.
| Compound Name | 1-[4-[(2,3,6-trichlorophenyl)methylamino]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 43234694 |
| Molecular Formula | C14H17Cl3N2O |
| Molecular Weight | 335.66 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | 1-[4-[(2,3,6-trichlorophenyl)methylamino]piperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCC(NCc2c(Cl)ccc(Cl)c2Cl)CC1 |
| InChI | InChI=1S/C14H17Cl3N2O/c1-9(20)19-6-4-10(5-7-19)18-8-11-12(15)2-3-13(16)14(11)17/h2-3,10,18H,4-8H2,1H3 |
| InChIKey | NSQYXLVIMXCGMO-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.66 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|