C18H27BrN2OS — CID 126835326
1-[4-[(3-bromo-2-tert-butylsulfanylphenyl)methylamino]piperidin-1-yl]ethanone (PubChem CID 126835326) has the molecular formula C18H27BrN2OS and a molecular weight of 399.40 g/mol. Its IUPAC name is 1-[4-[(3-bromo-2-tert-butylsulfanylphenyl)methylamino]piperidin-1-yl]ethanone.
| Compound Name | 1-[4-[(3-bromo-2-tert-butylsulfanylphenyl)methylamino]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 126835326 |
| Molecular Formula | C18H27BrN2OS |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | 1-[4-[(3-bromo-2-tert-butylsulfanylphenyl)methylamino]piperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCC(NCc2cccc(Br)c2SC(C)(C)C)CC1 |
| InChI | InChI=1S/C18H27BrN2OS/c1-13(22)21-10-8-15(9-11-21)20-12-14-6-5-7-16(19)17(14)23-18(2,3)4/h5-7,15,20H,8-12H2,1-4H3 |
| InChIKey | JDIWAZFCNIJNFF-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |