C19H23NO2 — CID 122030981
3-[[(3-methyl-3-phenylbutan-2-yl)amino]methyl]benzoic acid (PubChem CID 122030981) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is 3-[[(3-methyl-3-phenylbutan-2-yl)amino]methyl]benzoic acid.
| Compound Name | 3-[[(3-methyl-3-phenylbutan-2-yl)amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 122030981 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | 3-[[(3-methyl-3-phenylbutan-2-yl)amino]methyl]benzoic acid |
| SMILES | CC(NCc1cccc(C(=O)O)c1)C(C)(C)c1ccccc1 |
| InChI | InChI=1S/C19H23NO2/c1-14(19(2,3)17-10-5-4-6-11-17)20-13-15-8-7-9-16(12-15)18(21)22/h4-12,14,20H,13H2,1-3H3,(H,21,22) |
| InChIKey | FUIQNAAYQCGVBJ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |