C20H25NO2 — CID 122031619
3-[[(2-methyl-2-phenylpentan-3-yl)amino]methyl]benzoic acid (PubChem CID 122031619) has the molecular formula C20H25NO2 and a molecular weight of 311.43 g/mol. Its IUPAC name is 3-[[(2-methyl-2-phenylpentan-3-yl)amino]methyl]benzoic acid.
| Compound Name | 3-[[(2-methyl-2-phenylpentan-3-yl)amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 122031619 |
| Molecular Formula | C20H25NO2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | 3-[[(2-methyl-2-phenylpentan-3-yl)amino]methyl]benzoic acid |
| SMILES | CCC(NCc1cccc(C(=O)O)c1)C(C)(C)c1ccccc1 |
| InChI | InChI=1S/C20H25NO2/c1-4-18(20(2,3)17-11-6-5-7-12-17)21-14-15-9-8-10-16(13-15)19(22)23/h5-13,18,21H,4,14H2,1-3H3,(H,22,23) |
| InChIKey | KFHBYKQWJAWEGJ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |