C19H21NO2 — CID 122031089
3-[[[cyclobutyl(phenyl)methyl]amino]methyl]benzoic acid (PubChem CID 122031089) has the molecular formula C19H21NO2 and a molecular weight of 295.38 g/mol. Its IUPAC name is 3-[[[cyclobutyl(phenyl)methyl]amino]methyl]benzoic acid.
| Compound Name | 3-[[[cyclobutyl(phenyl)methyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 122031089 |
| Molecular Formula | C19H21NO2 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | 3-[[[cyclobutyl(phenyl)methyl]amino]methyl]benzoic acid |
| SMILES | O=C(O)c1cccc(CNC(c2ccccc2)C2CCC2)c1 |
| InChI | InChI=1S/C19H21NO2/c21-19(22)17-11-4-6-14(12-17)13-20-18(16-9-5-10-16)15-7-2-1-3-8-15/h1-4,6-8,11-12,16,18,20H,5,9-10,13H2,(H,21,22) |
| InChIKey | KLSZQSIULRJRQV-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |