C19H21ClN2O2 — CID 122032243
3-[[[2-(4-chlorophenyl)-1-methylpyrrolidin-3-yl]amino]methyl]benzoic acid (PubChem CID 122032243) has the molecular formula C19H21ClN2O2 and a molecular weight of 344.84 g/mol. Its IUPAC name is 3-[[[2-(4-chlorophenyl)-1-methylpyrrolidin-3-yl]amino]methyl]benzoic acid.
| Compound Name | 3-[[[2-(4-chlorophenyl)-1-methylpyrrolidin-3-yl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 122032243 |
| Molecular Formula | C19H21ClN2O2 |
| Molecular Weight | 344.84 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 3-[[[2-(4-chlorophenyl)-1-methylpyrrolidin-3-yl]amino]methyl]benzoic acid |
| SMILES | CN1CCC(NCc2cccc(C(=O)O)c2)C1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H21ClN2O2/c1-22-10-9-17(18(22)14-5-7-16(20)8-6-14)21-12-13-3-2-4-15(11-13)19(23)24/h2-8,11,17-18,21H,9-10,12H2,1H3,(H,23,24) |
| InChIKey | DJKYYEXSBFUQKS-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.84 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |