C18H25NO4 — CID 122032455
4-[(1,4-dioxaspiro[4.6]undecan-3-ylmethylamino)methyl]benzoic acid (PubChem CID 122032455) has the molecular formula C18H25NO4 and a molecular weight of 319.40 g/mol. Its IUPAC name is 4-[(1,4-dioxaspiro[4.6]undecan-3-ylmethylamino)methyl]benzoic acid.
| Compound Name | 4-[(1,4-dioxaspiro[4.6]undecan-3-ylmethylamino)methyl]benzoic acid |
|---|---|
| PubChem CID | 122032455 |
| Molecular Formula | C18H25NO4 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | 4-[(1,4-dioxaspiro[4.6]undecan-3-ylmethylamino)methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CNCC2COC3(CCCCCC3)O2)cc1 |
| InChI | InChI=1S/C18H25NO4/c20-17(21)15-7-5-14(6-8-15)11-19-12-16-13-22-18(23-16)9-3-1-2-4-10-18/h5-8,16,19H,1-4,9-13H2,(H,20,21) |
| InChIKey | KONXCUSYTPRTTF-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |