C17H24N2O3 — CID 122033182
3-[(2,2-dimethyl-3-oxo-4-propylpiperazin-1-yl)methyl]benzoic acid (PubChem CID 122033182) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is 3-[(2,2-dimethyl-3-oxo-4-propylpiperazin-1-yl)methyl]benzoic acid.
| Compound Name | 3-[(2,2-dimethyl-3-oxo-4-propylpiperazin-1-yl)methyl]benzoic acid |
|---|---|
| PubChem CID | 122033182 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | 3-[(2,2-dimethyl-3-oxo-4-propylpiperazin-1-yl)methyl]benzoic acid |
| SMILES | CCCN1CCN(Cc2cccc(C(=O)O)c2)C(C)(C)C1=O |
| InChI | InChI=1S/C17H24N2O3/c1-4-8-18-9-10-19(17(2,3)16(18)22)12-13-6-5-7-14(11-13)15(20)21/h5-7,11H,4,8-10,12H2,1-3H3,(H,20,21) |
| InChIKey | PREDUAXCCYYXGI-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |