C17H29N3O2 — CID 122033442
4-[(5-ethyl-1-pentan-3-ylpyrazol-4-yl)amino]cyclohexane-1-carboxylic acid (PubChem CID 122033442) has the molecular formula C17H29N3O2 and a molecular weight of 307.44 g/mol. Its IUPAC name is 4-[(5-ethyl-1-pentan-3-ylpyrazol-4-yl)amino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[(5-ethyl-1-pentan-3-ylpyrazol-4-yl)amino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 122033442 |
| Molecular Formula | C17H29N3O2 |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.23 |
| IUPAC Name | 4-[(5-ethyl-1-pentan-3-ylpyrazol-4-yl)amino]cyclohexane-1-carboxylic acid |
| SMILES | CCc1c(NC2CCC(C(=O)O)CC2)cnn1C(CC)CC |
| InChI | InChI=1S/C17H29N3O2/c1-4-14(5-2)20-16(6-3)15(11-18-20)19-13-9-7-12(8-10-13)17(21)22/h11-14,19H,4-10H2,1-3H3,(H,21,22) |
| InChIKey | JTSGXGMRHQLNLQ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |