C18H30N4O3 — CID 122102953
1-[(5-ethyl-1-pentan-3-ylpyrazol-4-yl)carbamoyl]-5-methylpiperidine-3-carboxylic acid (PubChem CID 122102953) has the molecular formula C18H30N4O3 and a molecular weight of 350.46 g/mol. Its IUPAC name is 1-[(5-ethyl-1-pentan-3-ylpyrazol-4-yl)carbamoyl]-5-methylpiperidine-3-carboxylic acid.
| Compound Name | 1-[(5-ethyl-1-pentan-3-ylpyrazol-4-yl)carbamoyl]-5-methylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122102953 |
| Molecular Formula | C18H30N4O3 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.23 |
| IUPAC Name | 1-[(5-ethyl-1-pentan-3-ylpyrazol-4-yl)carbamoyl]-5-methylpiperidine-3-carboxylic acid |
| SMILES | CCc1c(NC(=O)N2CC(C)CC(C(=O)O)C2)cnn1C(CC)CC |
| InChI | InChI=1S/C18H30N4O3/c1-5-14(6-2)22-16(7-3)15(9-19-22)20-18(25)21-10-12(4)8-13(11-21)17(23)24/h9,12-14H,5-8,10-11H2,1-4H3,(H,20,25)(H,23,24) |
| InChIKey | HDOHJCFNEMOATG-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |