C21H24FNO3 — CID 122033505
4-[[[1-[(4-fluorophenyl)methyl]-2-hydroxycyclopentyl]methylamino]methyl]benzoic acid (PubChem CID 122033505) has the molecular formula C21H24FNO3 and a molecular weight of 357.43 g/mol. Its IUPAC name is 4-[[[1-[(4-fluorophenyl)methyl]-2-hydroxycyclopentyl]methylamino]methyl]benzoic acid.
| Compound Name | 4-[[[1-[(4-fluorophenyl)methyl]-2-hydroxycyclopentyl]methylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 122033505 |
| Molecular Formula | C21H24FNO3 |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 4-[[[1-[(4-fluorophenyl)methyl]-2-hydroxycyclopentyl]methylamino]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CNCC2(Cc3ccc(F)cc3)CCCC2O)cc1 |
| InChI | InChI=1S/C21H24FNO3/c22-18-9-5-15(6-10-18)12-21(11-1-2-19(21)24)14-23-13-16-3-7-17(8-4-16)20(25)26/h3-10,19,23-24H,1-2,11-14H2,(H,25,26) |
| InChIKey | VBVAOOYRDZTRBL-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |