About N-[[(1S,2R)-1-[(4-fluorophenyl)methyl]-2-hydroxycyclopentyl]methyl]oxane-4-carboxamide
N-[[(1S,2R)-1-[(4-fluorophenyl)methyl]-2-hydroxycyclopentyl]methyl]oxane-4-carboxamide (PubChem CID 125138903) has the molecular formula C19H26FNO3
and a molecular weight of 335.42 g/mol. Its IUPAC name is N-[[(1S,2R)-1-[(4-fluorophenyl)methyl]-2-hydroxycyclopentyl]methyl]oxane-4-carboxamide.
Molecular Properties
| Compound Name | N-[[(1S,2R)-1-[(4-fluorophenyl)methyl]-2-hydroxycyclopentyl]methyl]oxane-4-carboxamide |
| PubChem CID | 125138903 |
| Molecular Formula | C19H26FNO3 |
| Molecular Weight | 335.42 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | N-[[(1S,2R)-1-[(4-fluorophenyl)methyl]-2-hydroxycyclopentyl]methyl]oxane-4-carboxamide |
| SMILES | O=C(NC[C@@]1(Cc2ccc(F)cc2)CCC[C@H]1O)C1CCOCC1 |
| InChI | InChI=1S/C19H26FNO3/c20-16-5-3-14(4-6-16)12-19(9-1-2-17(19)22)13-21-18(23)15-7-10-24-11-8-15/h3-6,15,17,22H,1-2,7-13H2,(H,21,23)/t17-,19+/m1/s1 |
| InChIKey | OUMULTUFFWMCJV-MJGOQNOKSA-N |
| XLogP | 2.44 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.42 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[[(1S,2R)-1-[(4-fluorophenyl)methyl]-2-hydroxycyclopentyl]methyl]oxane-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[(1S,2R)-1-[(4-fluorophenyl)methyl]-2-hydroxycyclopentyl]methyl]oxane-4-carboxamide?
The IUPAC name of N-[[(1S,2R)-1-[(4-fluorophenyl)methyl]-2-hydroxycyclopentyl]methyl]oxane-4-carboxamide (CID 125138903) is N-[[(1S,2R)-1-[(4-fluorophenyl)methyl]-2-hydroxycyclopentyl]methyl]oxane-4-carboxamide.
What is the SMILES notation for N-[[(1S,2R)-1-[(4-fluorophenyl)methyl]-2-hydroxycyclopentyl]methyl]oxane-4-carboxamide?
The canonical SMILES for N-[[(1S,2R)-1-[(4-fluorophenyl)methyl]-2-hydroxycyclopentyl]methyl]oxane-4-carboxamide is O=C(NC[C@@]1(Cc2ccc(F)cc2)CCC[C@H]1O)C1CCOCC1.
What is the InChIKey of N-[[(1S,2R)-1-[(4-fluorophenyl)methyl]-2-hydroxycyclopentyl]methyl]oxane-4-carboxamide?
The InChIKey is OUMULTUFFWMCJV-MJGOQNOKSA-N. The full InChI is InChI=1S/C19H26FNO3/c20-16-5-3-14(4-6-16)12-19(9-1-2-17(19)22)13-21-18(23)15-7-10-24-11-8-15/h3-6,15,17,22H,1-2,7-13H2,(H,21,23)/t17-,19+/m1/s1.
What are the key properties of N-[[(1S,2R)-1-[(4-fluorophenyl)methyl]-2-hydroxycyclopentyl]methyl]oxane-4-carboxamide?
N-[[(1S,2R)-1-[(4-fluorophenyl)methyl]-2-hydroxycyclopentyl]methyl]oxane-4-carboxamide has a molecular weight of 335.42 g/mol, XLogP of 2.44, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[(1S,2R)-1-[(4-fluorophenyl)methyl]-2-hydroxycyclopentyl]methyl]oxane-4-carboxamide is sourced from PubChem (CID 125138903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).