C20H23NO4 — CID 122035299
4-[[3-[(3,5-dimethoxyphenyl)methyl]azetidin-1-yl]methyl]benzoic acid (PubChem CID 122035299) has the molecular formula C20H23NO4 and a molecular weight of 341.41 g/mol. Its IUPAC name is 4-[[3-[(3,5-dimethoxyphenyl)methyl]azetidin-1-yl]methyl]benzoic acid.
| Compound Name | 4-[[3-[(3,5-dimethoxyphenyl)methyl]azetidin-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 122035299 |
| Molecular Formula | C20H23NO4 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | 4-[[3-[(3,5-dimethoxyphenyl)methyl]azetidin-1-yl]methyl]benzoic acid |
| SMILES | COc1cc(CC2CN(Cc3ccc(C(=O)O)cc3)C2)cc(OC)c1 |
| InChI | InChI=1S/C20H23NO4/c1-24-18-8-15(9-19(10-18)25-2)7-16-12-21(13-16)11-14-3-5-17(6-4-14)20(22)23/h3-6,8-10,16H,7,11-13H2,1-2H3,(H,22,23) |
| InChIKey | DWHDRGLMYXRNPO-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |