C20H24ClNO5 — CID 122036777
2-[[4-[2-(2-chlorophenoxy)ethoxy]-3-methoxyphenyl]methyl-methylamino]propanoic acid (PubChem CID 122036777) has the molecular formula C20H24ClNO5 and a molecular weight of 393.87 g/mol. Its IUPAC name is 2-[[4-[2-(2-chlorophenoxy)ethoxy]-3-methoxyphenyl]methyl-methylamino]propanoic acid.
| Compound Name | 2-[[4-[2-(2-chlorophenoxy)ethoxy]-3-methoxyphenyl]methyl-methylamino]propanoic acid |
|---|---|
| PubChem CID | 122036777 |
| Molecular Formula | C20H24ClNO5 |
| Molecular Weight | 393.87 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | 2-[[4-[2-(2-chlorophenoxy)ethoxy]-3-methoxyphenyl]methyl-methylamino]propanoic acid |
| SMILES | COc1cc(CN(C)C(C)C(=O)O)ccc1OCCOc1ccccc1Cl |
| InChI | InChI=1S/C20H24ClNO5/c1-14(20(23)24)22(2)13-15-8-9-18(19(12-15)25-3)27-11-10-26-17-7-5-4-6-16(17)21/h4-9,12,14H,10-11,13H2,1-3H3,(H,23,24) |
| InChIKey | FRAMBXPBZNCZED-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.87 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|