About (2R)-1-[(3,5-dibromo-2-pyridinyl)methyl]pyrrolidine-2-carboxylic acid
(2R)-1-[(3,5-dibromo-2-pyridinyl)methyl]pyrrolidine-2-carboxylic acid (PubChem CID 122038436) has the molecular formula C11H12Br2N2O2
and a molecular weight of 364.04 g/mol. Its IUPAC name is (2R)-1-[(3,5-dibromo-2-pyridinyl)methyl]pyrrolidine-2-carboxylic acid.
Molecular Properties
| Compound Name | (2R)-1-[(3,5-dibromo-2-pyridinyl)methyl]pyrrolidine-2-carboxylic acid |
| PubChem CID | 122038436 |
| Molecular Formula | C11H12Br2N2O2 |
| Molecular Weight | 364.04 g/mol |
| Exact Mass | 361.93 |
| IUPAC Name | (2R)-1-[(3,5-dibromo-2-pyridinyl)methyl]pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@H]1CCCN1Cc1ncc(Br)cc1Br |
| InChI | InChI=1S/C11H12Br2N2O2/c12-7-4-8(13)9(14-5-7)6-15-3-1-2-10(15)11(16)17/h4-5,10H,1-3,6H2,(H,16,17)/t10-/m1/s1 |
| InChIKey | UDGNKKHJWBUWLR-SNVBAGLBSA-N |
| XLogP | 2.66 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.04 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R)-1-[(3,5-dibromo-2-pyridinyl)methyl]pyrrolidine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-1-[(3,5-dibromo-2-pyridinyl)methyl]pyrrolidine-2-carboxylic acid?
The IUPAC name of (2R)-1-[(3,5-dibromo-2-pyridinyl)methyl]pyrrolidine-2-carboxylic acid (CID 122038436) is (2R)-1-[(3,5-dibromo-2-pyridinyl)methyl]pyrrolidine-2-carboxylic acid.
What is the SMILES notation for (2R)-1-[(3,5-dibromo-2-pyridinyl)methyl]pyrrolidine-2-carboxylic acid?
The canonical SMILES for (2R)-1-[(3,5-dibromo-2-pyridinyl)methyl]pyrrolidine-2-carboxylic acid is O=C(O)[C@H]1CCCN1Cc1ncc(Br)cc1Br.
What is the InChIKey of (2R)-1-[(3,5-dibromo-2-pyridinyl)methyl]pyrrolidine-2-carboxylic acid?
The InChIKey is UDGNKKHJWBUWLR-SNVBAGLBSA-N. The full InChI is InChI=1S/C11H12Br2N2O2/c12-7-4-8(13)9(14-5-7)6-15-3-1-2-10(15)11(16)17/h4-5,10H,1-3,6H2,(H,16,17)/t10-/m1/s1.
What are the key properties of (2R)-1-[(3,5-dibromo-2-pyridinyl)methyl]pyrrolidine-2-carboxylic acid?
(2R)-1-[(3,5-dibromo-2-pyridinyl)methyl]pyrrolidine-2-carboxylic acid has a molecular weight of 364.04 g/mol, XLogP of 2.66, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1-[(3,5-dibromo-2-pyridinyl)methyl]pyrrolidine-2-carboxylic acid is sourced from PubChem (CID 122038436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).