C12H14Br2N2O2 — CID 122036635
1-[(2-amino-3,5-dibromophenyl)methyl]pyrrolidine-2-carboxylic acid (PubChem CID 122036635) has the molecular formula C12H14Br2N2O2 and a molecular weight of 378.06 g/mol. Its IUPAC name is 1-[(2-amino-3,5-dibromophenyl)methyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[(2-amino-3,5-dibromophenyl)methyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 122036635 |
| Molecular Formula | C12H14Br2N2O2 |
| Molecular Weight | 378.06 g/mol |
| Exact Mass | 375.94 |
| IUPAC Name | 1-[(2-amino-3,5-dibromophenyl)methyl]pyrrolidine-2-carboxylic acid |
| SMILES | Nc1c(Br)cc(Br)cc1CN1CCCC1C(=O)O |
| InChI | InChI=1S/C12H14Br2N2O2/c13-8-4-7(11(15)9(14)5-8)6-16-3-1-2-10(16)12(17)18/h4-5,10H,1-3,6,15H2,(H,17,18) |
| InChIKey | WCKVTSQIZNKULZ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.06 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|