C13H14BrF2NO3 — CID 122038447
(2R)-1-[[3-bromo-4-(difluoromethoxy)phenyl]methyl]pyrrolidine-2-carboxylic acid (PubChem CID 122038447) has the molecular formula C13H14BrF2NO3 and a molecular weight of 350.16 g/mol. Its IUPAC name is (2R)-1-[[3-bromo-4-(difluoromethoxy)phenyl]methyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2R)-1-[[3-bromo-4-(difluoromethoxy)phenyl]methyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 122038447 |
| Molecular Formula | C13H14BrF2NO3 |
| Molecular Weight | 350.16 g/mol |
| Exact Mass | 349.01 |
| IUPAC Name | (2R)-1-[[3-bromo-4-(difluoromethoxy)phenyl]methyl]pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@H]1CCCN1Cc1ccc(OC(F)F)c(Br)c1 |
| InChI | InChI=1S/C13H14BrF2NO3/c14-9-6-8(3-4-11(9)20-13(15)16)7-17-5-1-2-10(17)12(18)19/h3-4,6,10,13H,1-2,5,7H2,(H,18,19)/t10-/m1/s1 |
| InChIKey | AKQDLFVCVCORRS-SNVBAGLBSA-N |
| XLogP | 3.10 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.16 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |