C14H20BrNO3S — CID 122040932
3-[(4-bromo-2-propan-2-ylsulfanylphenyl)methylamino]-2-hydroxy-2-methylpropanoic acid (PubChem CID 122040932) has the molecular formula C14H20BrNO3S and a molecular weight of 362.29 g/mol. Its IUPAC name is 3-[(4-bromo-2-propan-2-ylsulfanylphenyl)methylamino]-2-hydroxy-2-methylpropanoic acid.
| Compound Name | 3-[(4-bromo-2-propan-2-ylsulfanylphenyl)methylamino]-2-hydroxy-2-methylpropanoic acid |
|---|---|
| PubChem CID | 122040932 |
| Molecular Formula | C14H20BrNO3S |
| Molecular Weight | 362.29 g/mol |
| Exact Mass | 361.03 |
| IUPAC Name | 3-[(4-bromo-2-propan-2-ylsulfanylphenyl)methylamino]-2-hydroxy-2-methylpropanoic acid |
| SMILES | CC(C)Sc1cc(Br)ccc1CNCC(C)(O)C(=O)O |
| InChI | InChI=1S/C14H20BrNO3S/c1-9(2)20-12-6-11(15)5-4-10(12)7-16-8-14(3,19)13(17)18/h4-6,9,16,19H,7-8H2,1-3H3,(H,17,18) |
| InChIKey | BDFUOMYWDMJRSY-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.29 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |