C18H24ClNO4 — CID 122041086
1-[(3-chloro-5-ethoxy-4-hydroxyphenyl)methyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid (PubChem CID 122041086) has the molecular formula C18H24ClNO4 and a molecular weight of 353.85 g/mol. Its IUPAC name is 1-[(3-chloro-5-ethoxy-4-hydroxyphenyl)methyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid.
| Compound Name | 1-[(3-chloro-5-ethoxy-4-hydroxyphenyl)methyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
|---|---|
| PubChem CID | 122041086 |
| Molecular Formula | C18H24ClNO4 |
| Molecular Weight | 353.85 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | 1-[(3-chloro-5-ethoxy-4-hydroxyphenyl)methyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
| SMILES | CCOc1cc(CN2C(C(=O)O)CC3CCCCC32)cc(Cl)c1O |
| InChI | InChI=1S/C18H24ClNO4/c1-2-24-16-8-11(7-13(19)17(16)21)10-20-14-6-4-3-5-12(14)9-15(20)18(22)23/h7-8,12,14-15,21H,2-6,9-10H2,1H3,(H,22,23) |
| InChIKey | FBTYBYZVZJUDEU-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.85 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |