C19H28N2O2 — CID 122041350
2-[cyclopropylmethyl-[3-[2-(3-methylphenyl)ethylamino]cyclobutyl]amino]acetic acid (PubChem CID 122041350) has the molecular formula C19H28N2O2 and a molecular weight of 316.44 g/mol. Its IUPAC name is 2-[cyclopropylmethyl-[3-[2-(3-methylphenyl)ethylamino]cyclobutyl]amino]acetic acid.
| Compound Name | 2-[cyclopropylmethyl-[3-[2-(3-methylphenyl)ethylamino]cyclobutyl]amino]acetic acid |
|---|---|
| PubChem CID | 122041350 |
| Molecular Formula | C19H28N2O2 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | 2-[cyclopropylmethyl-[3-[2-(3-methylphenyl)ethylamino]cyclobutyl]amino]acetic acid |
| SMILES | Cc1cccc(CCNC2CC(N(CC(=O)O)CC3CC3)C2)c1 |
| InChI | InChI=1S/C19H28N2O2/c1-14-3-2-4-15(9-14)7-8-20-17-10-18(11-17)21(13-19(22)23)12-16-5-6-16/h2-4,9,16-18,20H,5-8,10-13H2,1H3,(H,22,23) |
| InChIKey | IDECOENLFUSBBD-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |