C21H27N3O2 — CID 122041663
2-[cyclopropylmethyl-[3-[(2-methylquinolin-6-yl)methylamino]cyclobutyl]amino]acetic acid (PubChem CID 122041663) has the molecular formula C21H27N3O2 and a molecular weight of 353.47 g/mol. Its IUPAC name is 2-[cyclopropylmethyl-[3-[(2-methylquinolin-6-yl)methylamino]cyclobutyl]amino]acetic acid.
| Compound Name | 2-[cyclopropylmethyl-[3-[(2-methylquinolin-6-yl)methylamino]cyclobutyl]amino]acetic acid |
|---|---|
| PubChem CID | 122041663 |
| Molecular Formula | C21H27N3O2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | 2-[cyclopropylmethyl-[3-[(2-methylquinolin-6-yl)methylamino]cyclobutyl]amino]acetic acid |
| SMILES | Cc1ccc2cc(CNC3CC(N(CC(=O)O)CC4CC4)C3)ccc2n1 |
| InChI | InChI=1S/C21H27N3O2/c1-14-2-6-17-8-16(5-7-20(17)23-14)11-22-18-9-19(10-18)24(13-21(25)26)12-15-3-4-15/h2,5-8,15,18-19,22H,3-4,9-13H2,1H3,(H,25,26) |
| InChIKey | VYNKATFMLMABII-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |