C16H24N4O2 — CID 122041579
2-[cyclopropylmethyl-[3-[(1-ethenylpyrazol-4-yl)methylamino]cyclobutyl]amino]acetic acid (PubChem CID 122041579) has the molecular formula C16H24N4O2 and a molecular weight of 304.39 g/mol. Its IUPAC name is 2-[cyclopropylmethyl-[3-[(1-ethenylpyrazol-4-yl)methylamino]cyclobutyl]amino]acetic acid.
| Compound Name | 2-[cyclopropylmethyl-[3-[(1-ethenylpyrazol-4-yl)methylamino]cyclobutyl]amino]acetic acid |
|---|---|
| PubChem CID | 122041579 |
| Molecular Formula | C16H24N4O2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | 2-[cyclopropylmethyl-[3-[(1-ethenylpyrazol-4-yl)methylamino]cyclobutyl]amino]acetic acid |
| SMILES | C=Cn1cc(CNC2CC(N(CC(=O)O)CC3CC3)C2)cn1 |
| InChI | InChI=1S/C16H24N4O2/c1-2-20-10-13(8-18-20)7-17-14-5-15(6-14)19(11-16(21)22)9-12-3-4-12/h2,8,10,12,14-15,17H,1,3-7,9,11H2,(H,21,22) |
| InChIKey | ZNLSPZDAOSDDDS-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |