C22H28N2O2 — CID 122044526
3-[3-[[1-(2-phenylethyl)piperidin-4-yl]amino]phenyl]propanoic acid (PubChem CID 122044526) has the molecular formula C22H28N2O2 and a molecular weight of 352.48 g/mol. Its IUPAC name is 3-[3-[[1-(2-phenylethyl)piperidin-4-yl]amino]phenyl]propanoic acid.
| Compound Name | 3-[3-[[1-(2-phenylethyl)piperidin-4-yl]amino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 122044526 |
| Molecular Formula | C22H28N2O2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | 3-[3-[[1-(2-phenylethyl)piperidin-4-yl]amino]phenyl]propanoic acid |
| SMILES | O=C(O)CCc1cccc(NC2CCN(CCc3ccccc3)CC2)c1 |
| InChI | InChI=1S/C22H28N2O2/c25-22(26)10-9-19-7-4-8-21(17-19)23-20-12-15-24(16-13-20)14-11-18-5-2-1-3-6-18/h1-8,17,20,23H,9-16H2,(H,25,26) |
| InChIKey | ZNGQYXVYROZNTH-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |