C14H27NO2S — CID 122044704
(2S)-2-[(5-tert-butylthiolan-3-yl)amino]hexanoic acid (PubChem CID 122044704) has the molecular formula C14H27NO2S and a molecular weight of 273.44 g/mol. Its IUPAC name is (2S)-2-[(5-tert-butylthiolan-3-yl)amino]hexanoic acid.
| Compound Name | (2S)-2-[(5-tert-butylthiolan-3-yl)amino]hexanoic acid |
|---|---|
| PubChem CID | 122044704 |
| Molecular Formula | C14H27NO2S |
| Molecular Weight | 273.44 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | (2S)-2-[(5-tert-butylthiolan-3-yl)amino]hexanoic acid |
| SMILES | CCCC[C@H](NC1CSC(C(C)(C)C)C1)C(=O)O |
| InChI | InChI=1S/C14H27NO2S/c1-5-6-7-11(13(16)17)15-10-8-12(18-9-10)14(2,3)4/h10-12,15H,5-9H2,1-4H3,(H,16,17)/t10?,11-,12?/m0/s1 |
| InChIKey | IESNXASPPMMTPJ-CXQJBGSLSA-N |
| XLogP | 3.14 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.44 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |