C17H20BrN3O2 — CID 122045000
(3aS,6aR)-2-[(6-bromo-8-methylimidazo[1,2-a]pyridin-3-yl)methyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid (PubChem CID 122045000) has the molecular formula C17H20BrN3O2 and a molecular weight of 378.27 g/mol. Its IUPAC name is (3aS,6aR)-2-[(6-bromo-8-methylimidazo[1,2-a]pyridin-3-yl)methyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid.
| Compound Name | (3aS,6aR)-2-[(6-bromo-8-methylimidazo[1,2-a]pyridin-3-yl)methyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid |
|---|---|
| PubChem CID | 122045000 |
| Molecular Formula | C17H20BrN3O2 |
| Molecular Weight | 378.27 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | (3aS,6aR)-2-[(6-bromo-8-methylimidazo[1,2-a]pyridin-3-yl)methyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid |
| SMILES | Cc1cc(Br)cn2c(CN3C[C@@H]4CCC[C@@]4(C(=O)O)C3)cnc12 |
| InChI | InChI=1S/C17H20BrN3O2/c1-11-5-13(18)8-21-14(6-19-15(11)21)9-20-7-12-3-2-4-17(12,10-20)16(22)23/h5-6,8,12H,2-4,7,9-10H2,1H3,(H,22,23)/t12-,17+/m0/s1 |
| InChIKey | UQRLCOWOAIDFHL-YVEFUNNKSA-N |
| XLogP | 3.09 |
| TPSA | 57.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.27 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |