C23H27NO4 — CID 122045023
(3aS,6aR)-2-[(4-methoxy-3-phenylmethoxyphenyl)methyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid (PubChem CID 122045023) has the molecular formula C23H27NO4 and a molecular weight of 381.47 g/mol. Its IUPAC name is (3aS,6aR)-2-[(4-methoxy-3-phenylmethoxyphenyl)methyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid.
| Compound Name | (3aS,6aR)-2-[(4-methoxy-3-phenylmethoxyphenyl)methyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid |
|---|---|
| PubChem CID | 122045023 |
| Molecular Formula | C23H27NO4 |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | (3aS,6aR)-2-[(4-methoxy-3-phenylmethoxyphenyl)methyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid |
| SMILES | COc1ccc(CN2C[C@@H]3CCC[C@@]3(C(=O)O)C2)cc1OCc1ccccc1 |
| InChI | InChI=1S/C23H27NO4/c1-27-20-10-9-18(12-21(20)28-15-17-6-3-2-4-7-17)13-24-14-19-8-5-11-23(19,16-24)22(25)26/h2-4,6-7,9-10,12,19H,5,8,11,13-16H2,1H3,(H,25,26)/t19-,23+/m0/s1 |
| InChIKey | IBXUHWVODTZRDK-WMZHIEFXSA-N |
| XLogP | 3.96 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |