C17H20F3NO3S — CID 120679926
(3aS,6aR)-2-[[4-methoxy-3-(trifluoromethylsulfanyl)phenyl]methyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid (PubChem CID 120679926) has the molecular formula C17H20F3NO3S and a molecular weight of 375.41 g/mol. Its IUPAC name is (3aS,6aR)-2-[[4-methoxy-3-(trifluoromethylsulfanyl)phenyl]methyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid.
| Compound Name | (3aS,6aR)-2-[[4-methoxy-3-(trifluoromethylsulfanyl)phenyl]methyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid |
|---|---|
| PubChem CID | 120679926 |
| Molecular Formula | C17H20F3NO3S |
| Molecular Weight | 375.41 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | (3aS,6aR)-2-[[4-methoxy-3-(trifluoromethylsulfanyl)phenyl]methyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid |
| SMILES | COc1ccc(CN2C[C@@H]3CCC[C@@]3(C(=O)O)C2)cc1SC(F)(F)F |
| InChI | InChI=1S/C17H20F3NO3S/c1-24-13-5-4-11(7-14(13)25-17(18,19)20)8-21-9-12-3-2-6-16(12,10-21)15(22)23/h4-5,7,12H,2-3,6,8-10H2,1H3,(H,22,23)/t12-,16+/m0/s1 |
| InChIKey | BQURDCGDXRGLMN-BLLLJJGKSA-N |
| XLogP | 3.99 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.41 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |