C17H23NO4 — CID 137336144
(3aR,7aR)-2-[(4-methoxy-3-methylphenyl)methyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid (PubChem CID 137336144) has the molecular formula C17H23NO4 and a molecular weight of 305.37 g/mol. Its IUPAC name is (3aR,7aR)-2-[(4-methoxy-3-methylphenyl)methyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid.
| Compound Name | (3aR,7aR)-2-[(4-methoxy-3-methylphenyl)methyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid |
|---|---|
| PubChem CID | 137336144 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | (3aR,7aR)-2-[(4-methoxy-3-methylphenyl)methyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid |
| SMILES | COc1ccc(CN2C[C@@H]3COCC[C@]3(C(=O)O)C2)cc1C |
| InChI | InChI=1S/C17H23NO4/c1-12-7-13(3-4-15(12)21-2)8-18-9-14-10-22-6-5-17(14,11-18)16(19)20/h3-4,7,14H,5-6,8-11H2,1-2H3,(H,19,20)/t14-,17+/m1/s1 |
| InChIKey | FDOBJPVQKSYKJV-PBHICJAKSA-N |
| XLogP | 1.93 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |